C22H27NO5 — CID 20993535
3-[4-methoxy-2-(2-morpholin-4-ylethoxy)phenyl]-2-phenylpropanoic acid (PubChem CID 20993535) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-[4-methoxy-2-(2-morpholin-4-ylethoxy)phenyl]-2-phenylpropanoic acid.
| Compound Name | 3-[4-methoxy-2-(2-morpholin-4-ylethoxy)phenyl]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 20993535 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 3-[4-methoxy-2-(2-morpholin-4-ylethoxy)phenyl]-2-phenylpropanoic acid |
| SMILES | COc1ccc(CC(C(=O)O)c2ccccc2)c(OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H27NO5/c1-26-19-8-7-18(15-20(22(24)25)17-5-3-2-4-6-17)21(16-19)28-14-11-23-9-12-27-13-10-23/h2-8,16,20H,9-15H2,1H3,(H,24,25) |
| InChIKey | HVMPINKTGUAUQH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |