C19H22ClNO4S — CID 20990784
3-[5-chloro-2-(2-morpholin-4-ylethoxy)phenyl]-2-thiophen-2-ylpropanoic acid (PubChem CID 20990784) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is 3-[5-chloro-2-(2-morpholin-4-ylethoxy)phenyl]-2-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[5-chloro-2-(2-morpholin-4-ylethoxy)phenyl]-2-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 20990784 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-[5-chloro-2-(2-morpholin-4-ylethoxy)phenyl]-2-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)C(Cc1cc(Cl)ccc1OCCN1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C19H22ClNO4S/c20-15-3-4-17(25-10-7-21-5-8-24-9-6-21)14(12-15)13-16(19(22)23)18-2-1-11-26-18/h1-4,11-12,16H,5-10,13H2,(H,22,23) |
| InChIKey | MFAPUFNTKJGYEE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |