3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid

C19H22O6 — CID 112720015

IUPAC3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid
SMILESCOc1ccccc1CC(C(=O)O)c1ccc(OC)c(OC)c1OC
InChIInChI=1S/C19H22O6/c1-22-15-8-6-5-7-12(15)11-14(19(20)21)13-9-10-16(23-2)18(25-4)17(13)24-3/h5-10,14H,11H2,1-4H3,(H,20,21)
InChIKeyZNVJKFYCZVWKSF-UHFFFAOYSA-N
MW346.38 g/mol
LogP3.13
Rot. Bonds8

About 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid

3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid (PubChem CID 112720015) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid.

Molecular Properties

Compound Name3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid
PubChem CID112720015
Molecular FormulaC19H22O6
Molecular Weight346.38 g/mol
Exact Mass346.14
IUPAC Name3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid
SMILESCOc1ccccc1CC(C(=O)O)c1ccc(OC)c(OC)c1OC
InChIInChI=1S/C19H22O6/c1-22-15-8-6-5-7-12(15)11-14(19(20)21)13-9-10-16(23-2)18(25-4)17(13)24-3/h5-10,14H,11H2,1-4H3,(H,20,21)
InChIKeyZNVJKFYCZVWKSF-UHFFFAOYSA-N
XLogP3.13
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.38
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid?
The IUPAC name of 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid (CID 112720015) is 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid.
What is the SMILES notation for 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid?
The canonical SMILES for 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid is COc1ccccc1CC(C(=O)O)c1ccc(OC)c(OC)c1OC.
What is the InChIKey of 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid?
The InChIKey is ZNVJKFYCZVWKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O6/c1-22-15-8-6-5-7-12(15)11-14(19(20)21)13-9-10-16(23-2)18(25-4)17(13)24-3/h5-10,14H,11H2,1-4H3,(H,20,21).
What are the key properties of 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid?
3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid has a molecular weight of 346.38 g/mol, XLogP of 3.13, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyphenyl)-2-(2,3,4-trimethoxyphenyl)propanoic acid is sourced from PubChem (CID 112720015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).