C14H13ClN2O3 — CID 104572864
2-(5-chloropyrimidin-2-yl)-3-(2-methoxyphenyl)propanoic acid (PubChem CID 104572864) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is 2-(5-chloropyrimidin-2-yl)-3-(2-methoxyphenyl)propanoic acid.
| Compound Name | 2-(5-chloropyrimidin-2-yl)-3-(2-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 104572864 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-(5-chloropyrimidin-2-yl)-3-(2-methoxyphenyl)propanoic acid |
| SMILES | COc1ccccc1CC(C(=O)O)c1ncc(Cl)cn1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-20-12-5-3-2-4-9(12)6-11(14(18)19)13-16-7-10(15)8-17-13/h2-5,7-8,11H,6H2,1H3,(H,18,19) |
| InChIKey | HRSWFAYXFXUTPL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |