C17H19N3O2 — CID 90028154
N-(diaminomethylidene)-3-(2-methoxyphenyl)-2-phenylpropanamide (PubChem CID 90028154) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-(2-methoxyphenyl)-2-phenylpropanamide.
| Compound Name | N-(diaminomethylidene)-3-(2-methoxyphenyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 90028154 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(diaminomethylidene)-3-(2-methoxyphenyl)-2-phenylpropanamide |
| SMILES | COc1ccccc1CC(C(=O)N=C(N)N)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c1-22-15-10-6-5-9-13(15)11-14(16(21)20-17(18)19)12-7-3-2-4-8-12/h2-10,14H,11H2,1H3,(H4,18,19,20,21) |
| InChIKey | WVNXYTFQNHNIGV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|