C20H19N3O — CID 90028017
(2R)-N-(diaminomethylidene)-3-naphthalen-2-yl-2-phenylpropanamide (PubChem CID 90028017) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is (2R)-N-(diaminomethylidene)-3-naphthalen-2-yl-2-phenylpropanamide.
| Compound Name | (2R)-N-(diaminomethylidene)-3-naphthalen-2-yl-2-phenylpropanamide |
|---|---|
| PubChem CID | 90028017 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (2R)-N-(diaminomethylidene)-3-naphthalen-2-yl-2-phenylpropanamide |
| SMILES | NC(N)=NC(=O)[C@H](Cc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O/c21-20(22)23-19(24)18(16-7-2-1-3-8-16)13-14-10-11-15-6-4-5-9-17(15)12-14/h1-12,18H,13H2,(H4,21,22,23,24)/t18-/m1/s1 |
| InChIKey | XEEWNRRHQVYKOV-GOSISDBHSA-N |
| XLogP | 2.97 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|