C18H19ClF3N3O2 — CID 90028122
N-(diaminomethylidene)-3-(4-methylphenyl)-2-[3-(trifluoromethoxy)phenyl]propanamide;hydrochloride (PubChem CID 90028122) has the molecular formula C18H19ClF3N3O2 and a molecular weight of 401.82 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-(4-methylphenyl)-2-[3-(trifluoromethoxy)phenyl]propanamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-3-(4-methylphenyl)-2-[3-(trifluoromethoxy)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 90028122 |
| Molecular Formula | C18H19ClF3N3O2 |
| Molecular Weight | 401.82 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-(diaminomethylidene)-3-(4-methylphenyl)-2-[3-(trifluoromethoxy)phenyl]propanamide;hydrochloride |
| SMILES | Cc1ccc(CC(C(=O)N=C(N)N)c2cccc(OC(F)(F)F)c2)cc1.Cl |
| InChI | InChI=1S/C18H18F3N3O2.ClH/c1-11-5-7-12(8-6-11)9-15(16(25)24-17(22)23)13-3-2-4-14(10-13)26-18(19,20)21;/h2-8,10,15H,9H2,1H3,(H4,22,23,24,25);1H |
| InChIKey | KZGITOWNDUPNMS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|