C24H22F6O10 — CID 87554932
diethyl 2-[3-(trifluoromethoxy)phenyl]propanedioate;2-[3-(trifluoromethoxy)phenyl]propanedioic acid (PubChem CID 87554932) has the molecular formula C24H22F6O10 and a molecular weight of 584.42 g/mol. Its IUPAC name is diethyl 2-[3-(trifluoromethoxy)phenyl]propanedioate;2-[3-(trifluoromethoxy)phenyl]propanedioic acid.
| Compound Name | diethyl 2-[3-(trifluoromethoxy)phenyl]propanedioate;2-[3-(trifluoromethoxy)phenyl]propanedioic acid |
|---|---|
| PubChem CID | 87554932 |
| Molecular Formula | C24H22F6O10 |
| Molecular Weight | 584.42 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | diethyl 2-[3-(trifluoromethoxy)phenyl]propanedioate;2-[3-(trifluoromethoxy)phenyl]propanedioic acid |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cccc(OC(F)(F)F)c1.O=C(O)C(C(=O)O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3O5.C10H7F3O5/c1-3-20-12(18)11(13(19)21-4-2)9-6-5-7-10(8-9)22-14(15,16)17;11-10(12,13)18-6-3-1-2-5(4-6)7(8(14)15)9(16)17/h5-8,11H,3-4H2,1-2H3;1-4,7H,(H,14,15)(H,16,17) |
| InChIKey | LMRNORSDAJKNGY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|