C16H16ClN3O — CID 123678595
2-(2-chlorophenyl)-N-(diaminomethylidene)-3-phenylpropanamide (PubChem CID 123678595) has the molecular formula C16H16ClN3O and a molecular weight of 301.78 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(diaminomethylidene)-3-phenylpropanamide.
| Compound Name | 2-(2-chlorophenyl)-N-(diaminomethylidene)-3-phenylpropanamide |
|---|---|
| PubChem CID | 123678595 |
| Molecular Formula | C16H16ClN3O |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(diaminomethylidene)-3-phenylpropanamide |
| SMILES | NC(N)=NC(=O)C(Cc1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C16H16ClN3O/c17-14-9-5-4-8-12(14)13(15(21)20-16(18)19)10-11-6-2-1-3-7-11/h1-9,13H,10H2,(H4,18,19,20,21) |
| InChIKey | UMYPINNZYACXRR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|