C16H16Cl3N3O — CID 90028549
N-(diaminomethylidene)-3-(2,4-dichlorophenyl)-2-phenylpropanamide;hydrochloride (PubChem CID 90028549) has the molecular formula C16H16Cl3N3O and a molecular weight of 372.68 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-(2,4-dichlorophenyl)-2-phenylpropanamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-3-(2,4-dichlorophenyl)-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 90028549 |
| Molecular Formula | C16H16Cl3N3O |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-(diaminomethylidene)-3-(2,4-dichlorophenyl)-2-phenylpropanamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)C(Cc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H15Cl2N3O.ClH/c17-12-7-6-11(14(18)9-12)8-13(15(22)21-16(19)20)10-4-2-1-3-5-10;/h1-7,9,13H,8H2,(H4,19,20,21,22);1H |
| InChIKey | VLHOTIBQRPDHKI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|