C17H15ClF3N3O — CID 144558766
(2R)-3-(3-chlorophenyl)-N-(diaminomethylidene)-2-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 144558766) has the molecular formula C17H15ClF3N3O and a molecular weight of 369.77 g/mol. Its IUPAC name is (2R)-3-(3-chlorophenyl)-N-(diaminomethylidene)-2-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-3-(3-chlorophenyl)-N-(diaminomethylidene)-2-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 144558766 |
| Molecular Formula | C17H15ClF3N3O |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | (2R)-3-(3-chlorophenyl)-N-(diaminomethylidene)-2-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | NC(N)=NC(=O)[C@H](Cc1cccc(Cl)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15ClF3N3O/c18-13-6-1-3-10(7-13)8-14(15(25)24-16(22)23)11-4-2-5-12(9-11)17(19,20)21/h1-7,9,14H,8H2,(H4,22,23,24,25)/t14-/m1/s1 |
| InChIKey | DIRQCIHUFRVMQK-CQSZACIVSA-N |
| XLogP | 3.49 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|