C18H21ClN4O2 — CID 90028577
2-(4-acetamidophenyl)-N-(diaminomethylidene)-3-phenylpropanamide;hydrochloride (PubChem CID 90028577) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-(diaminomethylidene)-3-phenylpropanamide;hydrochloride.
| Compound Name | 2-(4-acetamidophenyl)-N-(diaminomethylidene)-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 90028577 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-(diaminomethylidene)-3-phenylpropanamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(C(Cc2ccccc2)C(=O)N=C(N)N)cc1.Cl |
| InChI | InChI=1S/C18H20N4O2.ClH/c1-12(23)21-15-9-7-14(8-10-15)16(17(24)22-18(19)20)11-13-5-3-2-4-6-13;/h2-10,16H,11H2,1H3,(H,21,23)(H4,19,20,22,24);1H |
| InChIKey | LCRGNKXCLMSTIM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|