C9H6Cl4O — CID 21488826
2-chloro-3-(2,4-dichlorophenyl)propanoyl chloride (PubChem CID 21488826) has the molecular formula C9H6Cl4O and a molecular weight of 271.96 g/mol. Its IUPAC name is 2-chloro-3-(2,4-dichlorophenyl)propanoyl chloride.
| Compound Name | 2-chloro-3-(2,4-dichlorophenyl)propanoyl chloride |
|---|---|
| PubChem CID | 21488826 |
| Molecular Formula | C9H6Cl4O |
| Molecular Weight | 271.96 g/mol |
| Exact Mass | 269.92 |
| IUPAC Name | 2-chloro-3-(2,4-dichlorophenyl)propanoyl chloride |
| SMILES | O=C(Cl)C(Cl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl4O/c10-6-2-1-5(7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3H2 |
| InChIKey | FYFLYUWBJHDLBV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|