C13H15BrCl2O — CID 13034852
2-bromo-1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-one (PubChem CID 13034852) has the molecular formula C13H15BrCl2O and a molecular weight of 338.07 g/mol. Its IUPAC name is 2-bromo-1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 2-bromo-1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 13034852 |
| Molecular Formula | C13H15BrCl2O |
| Molecular Weight | 338.07 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 2-bromo-1-(2,4-dichlorophenyl)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C(Br)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15BrCl2O/c1-13(2,3)12(17)10(14)6-8-4-5-9(15)7-11(8)16/h4-5,7,10H,6H2,1-3H3 |
| InChIKey | KYOUNYVAUXSQHJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.07 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|