C13H15Br2FO — CID 62394652
2-bromo-1-(5-bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one (PubChem CID 62394652) has the molecular formula C13H15Br2FO and a molecular weight of 366.07 g/mol. Its IUPAC name is 2-bromo-1-(5-bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 2-bromo-1-(5-bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 62394652 |
| Molecular Formula | C13H15Br2FO |
| Molecular Weight | 366.07 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2-bromo-1-(5-bromo-2-fluorophenyl)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C(Br)Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H15Br2FO/c1-13(2,3)12(17)10(15)7-8-6-9(14)4-5-11(8)16/h4-6,10H,7H2,1-3H3 |
| InChIKey | ZYRMQLPPYXRARV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.07 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|