C13H16BrFO — CID 62393729
2-bromo-1-(2-fluorophenyl)-4,4-dimethylpentan-3-one (PubChem CID 62393729) has the molecular formula C13H16BrFO and a molecular weight of 287.17 g/mol. Its IUPAC name is 2-bromo-1-(2-fluorophenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 2-bromo-1-(2-fluorophenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 62393729 |
| Molecular Formula | C13H16BrFO |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-bromo-1-(2-fluorophenyl)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C(Br)Cc1ccccc1F |
| InChI | InChI=1S/C13H16BrFO/c1-13(2,3)12(16)10(14)8-9-6-4-5-7-11(9)15/h4-7,10H,8H2,1-3H3 |
| InChIKey | CWPLSKHNFPUJEA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|