C14H18BrFO — CID 55071639
2-bromo-1-(2-fluoro-4-methylphenyl)-4,4-dimethylpentan-3-one (PubChem CID 55071639) has the molecular formula C14H18BrFO and a molecular weight of 301.20 g/mol. Its IUPAC name is 2-bromo-1-(2-fluoro-4-methylphenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 2-bromo-1-(2-fluoro-4-methylphenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 55071639 |
| Molecular Formula | C14H18BrFO |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-bromo-1-(2-fluoro-4-methylphenyl)-4,4-dimethylpentan-3-one |
| SMILES | Cc1ccc(CC(Br)C(=O)C(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C14H18BrFO/c1-9-5-6-10(12(16)7-9)8-11(15)13(17)14(2,3)4/h5-7,11H,8H2,1-4H3 |
| InChIKey | IOJDSXREDGMYCB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|