C15H21FN2O3 — CID 123308039
tert-butyl N-[1-amino-3-(2-fluoro-4-methylphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 123308039) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is tert-butyl N-[1-amino-3-(2-fluoro-4-methylphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-amino-3-(2-fluoro-4-methylphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 123308039 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | tert-butyl N-[1-amino-3-(2-fluoro-4-methylphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1ccc(CC(NC(=O)OC(C)(C)C)C(N)=O)c(F)c1 |
| InChI | InChI=1S/C15H21FN2O3/c1-9-5-6-10(11(16)7-9)8-12(13(17)19)18-14(20)21-15(2,3)4/h5-7,12H,8H2,1-4H3,(H2,17,19)(H,18,20) |
| InChIKey | HPQMNFXUOSFYPB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |