C15H21FO2 — CID 166490305
tert-butyl (2S)-3-(2-fluoro-5-methylphenyl)-2-methylpropanoate (PubChem CID 166490305) has the molecular formula C15H21FO2 and a molecular weight of 252.33 g/mol. Its IUPAC name is tert-butyl (2S)-3-(2-fluoro-5-methylphenyl)-2-methylpropanoate.
| Compound Name | tert-butyl (2S)-3-(2-fluoro-5-methylphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 166490305 |
| Molecular Formula | C15H21FO2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | tert-butyl (2S)-3-(2-fluoro-5-methylphenyl)-2-methylpropanoate |
| SMILES | Cc1ccc(F)c(C[C@H](C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H21FO2/c1-10-6-7-13(16)12(8-10)9-11(2)14(17)18-15(3,4)5/h6-8,11H,9H2,1-5H3/t11-/m0/s1 |
| InChIKey | MTXQMARVFCKOOW-NSHDSACASA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |