C15H23ClNO2+ — CID 163727018
[2-amino-3-methyl-4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]phenyl]chloranium (PubChem CID 163727018) has the molecular formula C15H23ClNO2+ and a molecular weight of 284.81 g/mol. Its IUPAC name is [2-amino-3-methyl-4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]phenyl]chloranium.
| Compound Name | [2-amino-3-methyl-4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]phenyl]chloranium |
|---|---|
| PubChem CID | 163727018 |
| Molecular Formula | C15H23ClNO2+ |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [2-amino-3-methyl-4-[2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]phenyl]chloranium |
| SMILES | Cc1c(CC(C)C(=O)OC(C)(C)C)ccc([ClH+])c1N |
| InChI | InChI=1S/C15H23ClNO2/c1-9(14(18)19-15(3,4)5)8-11-6-7-12(16)13(17)10(11)2/h6-7,9,16H,8,17H2,1-5H3/q+1 |
| InChIKey | KWLSQQDNXCGBGF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|