C14H19FO2 — CID 174495539
tert-butyl (2R)-3-(4-fluorophenyl)-2-methylpropanoate (PubChem CID 174495539) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is tert-butyl (2R)-3-(4-fluorophenyl)-2-methylpropanoate.
| Compound Name | tert-butyl (2R)-3-(4-fluorophenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 174495539 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | tert-butyl (2R)-3-(4-fluorophenyl)-2-methylpropanoate |
| SMILES | C[C@H](Cc1ccc(F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H19FO2/c1-10(13(16)17-14(2,3)4)9-11-5-7-12(15)8-6-11/h5-8,10H,9H2,1-4H3/t10-/m1/s1 |
| InChIKey | NMEUPNAYHSQZFJ-SNVBAGLBSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |