C20H30FNO5 — CID 139916700
tert-butyl (2S)-3-(4-fluorophenyl)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 139916700) has the molecular formula C20H30FNO5 and a molecular weight of 383.46 g/mol. Its IUPAC name is tert-butyl (2S)-3-(4-fluorophenyl)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | tert-butyl (2S)-3-(4-fluorophenyl)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 139916700 |
| Molecular Formula | C20H30FNO5 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | tert-butyl (2S)-3-(4-fluorophenyl)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | COCN(C(=O)OC(C)(C)C)[C@@H](Cc1ccc(F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30FNO5/c1-19(2,3)26-17(23)16(12-14-8-10-15(21)11-9-14)22(13-25-7)18(24)27-20(4,5)6/h8-11,16H,12-13H2,1-7H3/t16-/m0/s1 |
| InChIKey | QCOVVELWFUYEQA-INIZCTEOSA-N |
| XLogP | 3.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|