C21H33NO6 — CID 139916693
butyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 139916693) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is butyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | butyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 139916693 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | butyl (2S)-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | CCCCOC(=O)[C@H](Cc1ccc(OC)cc1)N(COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO6/c1-7-8-13-27-19(23)18(14-16-9-11-17(26-6)12-10-16)22(15-25-5)20(24)28-21(2,3)4/h9-12,18H,7-8,13-15H2,1-6H3/t18-/m0/s1 |
| InChIKey | REGANOSIGIAOCN-SFHVURJKSA-N |
| XLogP | 3.79 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|