C26H33NO7 — CID 57276308
benzyl (2R)-2-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 57276308) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is benzyl (2R)-2-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | benzyl (2R)-2-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 57276308 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | benzyl (2R)-2-[(2-ethoxy-2-oxoethyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)CN(C(=O)OC(C)(C)C)[C@H](Cc1ccc(OC)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33NO7/c1-6-32-23(28)17-27(25(30)34-26(2,3)4)22(16-19-12-14-21(31-5)15-13-19)24(29)33-18-20-10-8-7-9-11-20/h7-15,22H,6,16-18H2,1-5H3/t22-/m1/s1 |
| InChIKey | VISLLNLUIBCYIV-JOCHJYFZSA-N |
| XLogP | 4.15 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|