C17H24N2O6 — CID 10617974
ethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethoxycarbonylamino]acetate (PubChem CID 10617974) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethoxycarbonylamino]acetate.
| Compound Name | ethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethoxycarbonylamino]acetate |
|---|---|
| PubChem CID | 10617974 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | ethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethoxycarbonylamino]acetate |
| SMILES | CCOC(=O)CN(NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O6/c1-5-23-14(20)11-19(18-15(21)25-17(2,3)4)16(22)24-12-13-9-7-6-8-10-13/h6-10H,5,11-12H2,1-4H3,(H,18,21) |
| InChIKey | JCRQAWDUOBRZIN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|