C23H36N4O6 — CID 59256369
benzyl N-[2-[[2,2-dimethyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-oxopropanoyl]-methylamino]ethyl]-N-methylcarbamate (PubChem CID 59256369) has the molecular formula C23H36N4O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is benzyl N-[2-[[2,2-dimethyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-oxopropanoyl]-methylamino]ethyl]-N-methylcarbamate.
| Compound Name | benzyl N-[2-[[2,2-dimethyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-oxopropanoyl]-methylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59256369 |
| Molecular Formula | C23H36N4O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | benzyl N-[2-[[2,2-dimethyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-oxopropanoyl]-methylamino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCN(C)C(=O)C(C)(C)C(=O)N(C)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H36N4O6/c1-22(2,3)33-20(30)24-27(8)19(29)23(4,5)18(28)25(6)14-15-26(7)21(31)32-16-17-12-10-9-11-13-17/h9-13H,14-16H2,1-8H3,(H,24,30) |
| InChIKey | LZUPLTNYWOYHHZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|