C18H28N2O3 — CID 178067850
tert-butyl N-[benzyl(2,2-dimethylbutanoyl)amino]carbamate (PubChem CID 178067850) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl N-[benzyl(2,2-dimethylbutanoyl)amino]carbamate.
| Compound Name | tert-butyl N-[benzyl(2,2-dimethylbutanoyl)amino]carbamate |
|---|---|
| PubChem CID | 178067850 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl N-[benzyl(2,2-dimethylbutanoyl)amino]carbamate |
| SMILES | CCC(C)(C)C(=O)N(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O3/c1-7-18(5,6)15(21)20(13-14-11-9-8-10-12-14)19-16(22)23-17(2,3)4/h8-12H,7,13H2,1-6H3,(H,19,22) |
| InChIKey | AASMCWJCBUABQO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|