C16H24N4O3S — CID 162421351
tert-butyl N-[[2-[benzyl(methyl)amino]-2-oxoethyl]-carbamothioylamino]carbamate (PubChem CID 162421351) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is tert-butyl N-[[2-[benzyl(methyl)amino]-2-oxoethyl]-carbamothioylamino]carbamate.
| Compound Name | tert-butyl N-[[2-[benzyl(methyl)amino]-2-oxoethyl]-carbamothioylamino]carbamate |
|---|---|
| PubChem CID | 162421351 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | tert-butyl N-[[2-[benzyl(methyl)amino]-2-oxoethyl]-carbamothioylamino]carbamate |
| SMILES | CN(Cc1ccccc1)C(=O)CN(NC(=O)OC(C)(C)C)C(N)=S |
| InChI | InChI=1S/C16H24N4O3S/c1-16(2,3)23-15(22)18-20(14(17)24)11-13(21)19(4)10-12-8-6-5-7-9-12/h5-9H,10-11H2,1-4H3,(H2,17,24)(H,18,22) |
| InChIKey | WQYIEHMIDLPPFS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|