C21H27ClN2O3 — CID 53439137
tert-butyl N-[2-[benzyl(methyl)amino]-2-oxo-1-phenylethyl]carbamate;hydrochloride (PubChem CID 53439137) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is tert-butyl N-[2-[benzyl(methyl)amino]-2-oxo-1-phenylethyl]carbamate;hydrochloride.
| Compound Name | tert-butyl N-[2-[benzyl(methyl)amino]-2-oxo-1-phenylethyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 53439137 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | tert-butyl N-[2-[benzyl(methyl)amino]-2-oxo-1-phenylethyl]carbamate;hydrochloride |
| SMILES | CN(Cc1ccccc1)C(=O)C(NC(=O)OC(C)(C)C)c1ccccc1.Cl |
| InChI | InChI=1S/C21H26N2O3.ClH/c1-21(2,3)26-20(25)22-18(17-13-9-6-10-14-17)19(24)23(4)15-16-11-7-5-8-12-16;/h5-14,18H,15H2,1-4H3,(H,22,25);1H |
| InChIKey | ZQCPTUSHTQJRRR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |