C19H29BrN4O4 — CID 142215965
tert-butyl N-[[2-[benzyl-[(2-bromoacetyl)amino]amino]-2-oxoethyl]-propylamino]carbamate (PubChem CID 142215965) has the molecular formula C19H29BrN4O4 and a molecular weight of 457.37 g/mol. Its IUPAC name is tert-butyl N-[[2-[benzyl-[(2-bromoacetyl)amino]amino]-2-oxoethyl]-propylamino]carbamate.
| Compound Name | tert-butyl N-[[2-[benzyl-[(2-bromoacetyl)amino]amino]-2-oxoethyl]-propylamino]carbamate |
|---|---|
| PubChem CID | 142215965 |
| Molecular Formula | C19H29BrN4O4 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | tert-butyl N-[[2-[benzyl-[(2-bromoacetyl)amino]amino]-2-oxoethyl]-propylamino]carbamate |
| SMILES | CCCN(CC(=O)N(Cc1ccccc1)NC(=O)CBr)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29BrN4O4/c1-5-11-23(22-18(27)28-19(2,3)4)14-17(26)24(21-16(25)12-20)13-15-9-7-6-8-10-15/h6-10H,5,11-14H2,1-4H3,(H,21,25)(H,22,27) |
| InChIKey | BWNOWXVEQRAZJB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|