C20H32N2O5 — CID 175456215
ethyl 2-[benzyl-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]acetate (PubChem CID 175456215) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is ethyl 2-[benzyl-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]acetate |
|---|---|
| PubChem CID | 175456215 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | ethyl 2-[benzyl-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)CC(O)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O5/c1-6-26-18(24)14-22(12-16-10-8-7-9-11-16)13-17(23)15(2)21-19(25)27-20(3,4)5/h7-11,15,17,23H,6,12-14H2,1-5H3,(H,21,25) |
| InChIKey | BJCOHRDWKBPELD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |