C26H32O6 — CID 160642057
6-O-benzyl 1-O-tert-butyl (2S,5R)-5-[(4-methoxyphenyl)methyl]-2-methyl-3-oxohexanedioate (PubChem CID 160642057) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is 6-O-benzyl 1-O-tert-butyl (2S,5R)-5-[(4-methoxyphenyl)methyl]-2-methyl-3-oxohexanedioate.
| Compound Name | 6-O-benzyl 1-O-tert-butyl (2S,5R)-5-[(4-methoxyphenyl)methyl]-2-methyl-3-oxohexanedioate |
|---|---|
| PubChem CID | 160642057 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 6-O-benzyl 1-O-tert-butyl (2S,5R)-5-[(4-methoxyphenyl)methyl]-2-methyl-3-oxohexanedioate |
| SMILES | COc1ccc(C[C@H](CC(=O)[C@H](C)C(=O)OC(C)(C)C)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H32O6/c1-18(24(28)32-26(2,3)4)23(27)16-21(15-19-11-13-22(30-5)14-12-19)25(29)31-17-20-9-7-6-8-10-20/h6-14,18,21H,15-17H2,1-5H3/t18-,21+/m0/s1 |
| InChIKey | GYQYLQNGKAIYDB-GHTZIAJQSA-N |
| XLogP | 4.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|