C30H39NO7 — CID 10602181
1-O-benzyl 4-O-tert-butyl (2S)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-phenylbutyl]butanedioate (PubChem CID 10602181) has the molecular formula C30H39NO7 and a molecular weight of 525.64 g/mol. Its IUPAC name is 1-O-benzyl 4-O-tert-butyl (2S)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-phenylbutyl]butanedioate.
| Compound Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-phenylbutyl]butanedioate |
|---|---|
| PubChem CID | 10602181 |
| Molecular Formula | C30H39NO7 |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-4-phenylbutyl]butanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H39NO7/c1-29(2,3)37-26(33)19-23(27(34)36-20-22-15-11-8-12-16-22)18-25(32)24(17-21-13-9-7-10-14-21)31-28(35)38-30(4,5)6/h7-16,23-24H,17-20H2,1-6H3,(H,31,35)/t23-,24-/m0/s1 |
| InChIKey | NQYSTLXNHBWHHI-ZEQRLZLVSA-N |
| XLogP | 5.17 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|