C18H27NO3 — CID 159506987
tert-butyl (2S,5R)-2-benzyl-5-(methylamino)-4-oxohexanoate (PubChem CID 159506987) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2-benzyl-5-(methylamino)-4-oxohexanoate.
| Compound Name | tert-butyl (2S,5R)-2-benzyl-5-(methylamino)-4-oxohexanoate |
|---|---|
| PubChem CID | 159506987 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl (2S,5R)-2-benzyl-5-(methylamino)-4-oxohexanoate |
| SMILES | CN[C@H](C)C(=O)C[C@H](Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO3/c1-13(19-5)16(20)12-15(17(21)22-18(2,3)4)11-14-9-7-6-8-10-14/h6-10,13,15,19H,11-12H2,1-5H3/t13-,15+/m1/s1 |
| InChIKey | ABMVFFPKVQNYEU-HIFRSBDPSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |