C37H36O10 — CID 177420239
1-O,1-O-dibenzyl 2-O,3-O-bis[(4-methoxyphenyl)methyl] (2R)-propane-1,1,2,3-tetracarboxylate (PubChem CID 177420239) has the molecular formula C37H36O10 and a molecular weight of 640.69 g/mol. Its IUPAC name is 1-O,1-O-dibenzyl 2-O,3-O-bis[(4-methoxyphenyl)methyl] (2R)-propane-1,1,2,3-tetracarboxylate.
| Compound Name | 1-O,1-O-dibenzyl 2-O,3-O-bis[(4-methoxyphenyl)methyl] (2R)-propane-1,1,2,3-tetracarboxylate |
|---|---|
| PubChem CID | 177420239 |
| Molecular Formula | C37H36O10 |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 1-O,1-O-dibenzyl 2-O,3-O-bis[(4-methoxyphenyl)methyl] (2R)-propane-1,1,2,3-tetracarboxylate |
| SMILES | COc1ccc(COC(=O)C[C@@H](C(=O)OCc2ccc(OC)cc2)C(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H36O10/c1-42-30-17-13-28(14-18-30)22-44-33(38)21-32(35(39)45-25-29-15-19-31(43-2)20-16-29)34(36(40)46-23-26-9-5-3-6-10-26)37(41)47-24-27-11-7-4-8-12-27/h3-20,32,34H,21-25H2,1-2H3/t32-/m1/s1 |
| InChIKey | YTYLAJRWFNLILW-JGCGQSQUSA-N |
| XLogP | 5.60 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|