C25H36N2O7 — CID 11751900
tert-butyl 3-[(2S)-3-ethoxy-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxopropyl]indole-1-carboxylate (PubChem CID 11751900) has the molecular formula C25H36N2O7 and a molecular weight of 476.57 g/mol. Its IUPAC name is tert-butyl 3-[(2S)-3-ethoxy-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxopropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2S)-3-ethoxy-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxopropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 11751900 |
| Molecular Formula | C25H36N2O7 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | tert-butyl 3-[(2S)-3-ethoxy-2-[methoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxopropyl]indole-1-carboxylate |
| SMILES | CCOC(=O)[C@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)N(COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H36N2O7/c1-9-32-21(28)20(27(16-31-8)23(30)34-25(5,6)7)14-17-15-26(22(29)33-24(2,3)4)19-13-11-10-12-18(17)19/h10-13,15,20H,9,14,16H2,1-8H3/t20-/m0/s1 |
| InChIKey | UFJPTDWXLJXVOD-FQEVSTJZSA-N |
| XLogP | 4.74 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|