C26H40N2O10 — CID 25199035
ethyl (2S)-4-[ethoxycarbonyl-[(4-methoxyphenyl)methyl]amino]-2-[2-methoxyethoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxobutanoate (PubChem CID 25199035) has the molecular formula C26H40N2O10 and a molecular weight of 540.61 g/mol. Its IUPAC name is ethyl (2S)-4-[ethoxycarbonyl-[(4-methoxyphenyl)methyl]amino]-2-[2-methoxyethoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxobutanoate.
| Compound Name | ethyl (2S)-4-[ethoxycarbonyl-[(4-methoxyphenyl)methyl]amino]-2-[2-methoxyethoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 25199035 |
| Molecular Formula | C26H40N2O10 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | ethyl (2S)-4-[ethoxycarbonyl-[(4-methoxyphenyl)methyl]amino]-2-[2-methoxyethoxymethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)[C@H](CC(=O)N(Cc1ccc(OC)cc1)C(=O)OCC)N(COCCOC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H40N2O10/c1-8-36-23(30)21(28(18-35-15-14-33-6)25(32)38-26(3,4)5)16-22(29)27(24(31)37-9-2)17-19-10-12-20(34-7)13-11-19/h10-13,21H,8-9,14-18H2,1-7H3/t21-/m0/s1 |
| InChIKey | PIBYDALTCXRUBK-NRFANRHFSA-N |
| XLogP | 3.36 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|