C17H21NO3S — CID 16686776
tert-butyl N-(4-methoxyphenyl)-N-(thiophen-3-ylmethyl)carbamate (PubChem CID 16686776) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is tert-butyl N-(4-methoxyphenyl)-N-(thiophen-3-ylmethyl)carbamate.
| Compound Name | tert-butyl N-(4-methoxyphenyl)-N-(thiophen-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 16686776 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | tert-butyl N-(4-methoxyphenyl)-N-(thiophen-3-ylmethyl)carbamate |
| SMILES | COc1ccc(N(Cc2ccsc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H21NO3S/c1-17(2,3)21-16(19)18(11-13-9-10-22-12-13)14-5-7-15(20-4)8-6-14/h5-10,12H,11H2,1-4H3 |
| InChIKey | SBILZAWFPPFGHF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |