C18H28N2O6S — CID 22944006
tert-butyl 2-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-(thiophen-3-ylmethyl)carbamoyl]oxyacetate (PubChem CID 22944006) has the molecular formula C18H28N2O6S and a molecular weight of 400.50 g/mol. Its IUPAC name is tert-butyl 2-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-(thiophen-3-ylmethyl)carbamoyl]oxyacetate.
| Compound Name | tert-butyl 2-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-(thiophen-3-ylmethyl)carbamoyl]oxyacetate |
|---|---|
| PubChem CID | 22944006 |
| Molecular Formula | C18H28N2O6S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | tert-butyl 2-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-(thiophen-3-ylmethyl)carbamoyl]oxyacetate |
| SMILES | CN(C(=O)OC(C)(C)C)N(Cc1ccsc1)C(=O)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O6S/c1-17(2,3)25-14(21)11-24-16(23)20(10-13-8-9-27-12-13)19(7)15(22)26-18(4,5)6/h8-9,12H,10-11H2,1-7H3 |
| InChIKey | WGPDZHSRYAXVOG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|