C16H26O3S — CID 10891867
tert-butyl (3R)-3-hydroxy-4-methyl-3-(2-thiophen-3-ylethyl)pentanoate (PubChem CID 10891867) has the molecular formula C16H26O3S and a molecular weight of 298.45 g/mol. Its IUPAC name is tert-butyl (3R)-3-hydroxy-4-methyl-3-(2-thiophen-3-ylethyl)pentanoate.
| Compound Name | tert-butyl (3R)-3-hydroxy-4-methyl-3-(2-thiophen-3-ylethyl)pentanoate |
|---|---|
| PubChem CID | 10891867 |
| Molecular Formula | C16H26O3S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | tert-butyl (3R)-3-hydroxy-4-methyl-3-(2-thiophen-3-ylethyl)pentanoate |
| SMILES | CC(C)[C@@](O)(CCc1ccsc1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26O3S/c1-12(2)16(18,8-6-13-7-9-20-11-13)10-14(17)19-15(3,4)5/h7,9,11-12,18H,6,8,10H2,1-5H3/t16-/m1/s1 |
| InChIKey | XSGAYNZBPLKTHA-MRXNPFEDSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |