About 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate
3-O-tert-butyl 1-O-thiophen-3-yl propanedioate (PubChem CID 159299934) has the molecular formula C11H14O4S
and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate.
Molecular Properties
| Compound Name | 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate |
| PubChem CID | 159299934 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate |
| SMILES | CC(C)(C)OC(=O)CC(=O)Oc1ccsc1 |
| InChI | InChI=1S/C11H14O4S/c1-11(2,3)15-10(13)6-9(12)14-8-4-5-16-7-8/h4-5,7H,6H2,1-3H3 |
| InChIKey | LBEYVKSLSBONOF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate?
The IUPAC name of 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate (CID 159299934) is 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate.
What is the SMILES notation for 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate?
The canonical SMILES for 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate is CC(C)(C)OC(=O)CC(=O)Oc1ccsc1.
What is the InChIKey of 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate?
The InChIKey is LBEYVKSLSBONOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4S/c1-11(2,3)15-10(13)6-9(12)14-8-4-5-16-7-8/h4-5,7H,6H2,1-3H3.
What are the key properties of 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate?
3-O-tert-butyl 1-O-thiophen-3-yl propanedioate has a molecular weight of 242.30 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-tert-butyl 1-O-thiophen-3-yl propanedioate is sourced from PubChem (CID 159299934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).