About bis(4-tert-butylphenyl) propanedioate
bis(4-tert-butylphenyl) propanedioate (PubChem CID 56991121) has the molecular formula C23H28O4
and a molecular weight of 368.47 g/mol. Its IUPAC name is bis(4-tert-butylphenyl) propanedioate.
Molecular Properties
| Compound Name | bis(4-tert-butylphenyl) propanedioate |
| PubChem CID | 56991121 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | bis(4-tert-butylphenyl) propanedioate |
| SMILES | CC(C)(C)c1ccc(OC(=O)CC(=O)Oc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H28O4/c1-22(2,3)16-7-11-18(12-8-16)26-20(24)15-21(25)27-19-13-9-17(10-14-19)23(4,5)6/h7-14H,15H2,1-6H3 |
| InChIKey | XOSZIKBJZWEWAR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(4-tert-butylphenyl) propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-tert-butylphenyl) propanedioate?
The IUPAC name of bis(4-tert-butylphenyl) propanedioate (CID 56991121) is bis(4-tert-butylphenyl) propanedioate.
What is the SMILES notation for bis(4-tert-butylphenyl) propanedioate?
The canonical SMILES for bis(4-tert-butylphenyl) propanedioate is CC(C)(C)c1ccc(OC(=O)CC(=O)Oc2ccc(C(C)(C)C)cc2)cc1.
What is the InChIKey of bis(4-tert-butylphenyl) propanedioate?
The InChIKey is XOSZIKBJZWEWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28O4/c1-22(2,3)16-7-11-18(12-8-16)26-20(24)15-21(25)27-19-13-9-17(10-14-19)23(4,5)6/h7-14H,15H2,1-6H3.
What are the key properties of bis(4-tert-butylphenyl) propanedioate?
bis(4-tert-butylphenyl) propanedioate has a molecular weight of 368.47 g/mol, XLogP of 5.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-tert-butylphenyl) propanedioate is sourced from PubChem (CID 56991121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).