C18H28O3 — CID 54454265
tert-butyl 3-hydroxy-4-methyl-3-(2-phenylethyl)pentanoate (PubChem CID 54454265) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-4-methyl-3-(2-phenylethyl)pentanoate.
| Compound Name | tert-butyl 3-hydroxy-4-methyl-3-(2-phenylethyl)pentanoate |
|---|---|
| PubChem CID | 54454265 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | tert-butyl 3-hydroxy-4-methyl-3-(2-phenylethyl)pentanoate |
| SMILES | CC(C)C(O)(CCc1ccccc1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28O3/c1-14(2)18(20,13-16(19)21-17(3,4)5)12-11-15-9-7-6-8-10-15/h6-10,14,20H,11-13H2,1-5H3 |
| InChIKey | WXBPSOGGQIXVPF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |