C15H21N3O2S — CID 114986293
tert-butyl N-[(1R)-1-[3-(thiophen-3-ylmethyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 114986293) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[3-(thiophen-3-ylmethyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[3-(thiophen-3-ylmethyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 114986293 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | tert-butyl N-[(1R)-1-[3-(thiophen-3-ylmethyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1cncn1Cc1ccsc1 |
| InChI | InChI=1S/C15H21N3O2S/c1-11(17-14(19)20-15(2,3)4)13-7-16-10-18(13)8-12-5-6-21-9-12/h5-7,9-11H,8H2,1-4H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | JYWWELHUAJAVOX-LLVKDONJSA-N |
| XLogP | 3.58 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |