C15H27N3O2 — CID 114986113
tert-butyl N-[(1R)-1-[3-(3-methylbutyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 114986113) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[3-(3-methylbutyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[3-(3-methylbutyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 114986113 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | tert-butyl N-[(1R)-1-[3-(3-methylbutyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | CC(C)CCn1cncc1[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O2/c1-11(2)7-8-18-10-16-9-13(18)12(3)17-14(19)20-15(4,5)6/h9-12H,7-8H2,1-6H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | ZALPNYFPIAFSJY-GFCCVEGCSA-N |
| XLogP | 3.51 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |