C15H28N4O2 — CID 114986278
tert-butyl N-[(1S)-1-[3-[2-[ethyl(methyl)amino]ethyl]imidazol-4-yl]ethyl]carbamate (PubChem CID 114986278) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[3-[2-[ethyl(methyl)amino]ethyl]imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[3-[2-[ethyl(methyl)amino]ethyl]imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 114986278 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl N-[(1S)-1-[3-[2-[ethyl(methyl)amino]ethyl]imidazol-4-yl]ethyl]carbamate |
| SMILES | CCN(C)CCn1cncc1[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N4O2/c1-7-18(6)8-9-19-11-16-10-13(19)12(2)17-14(20)21-15(3,4)5/h10-12H,7-9H2,1-6H3,(H,17,20)/t12-/m0/s1 |
| InChIKey | UDLKTQFKANASCK-LBPRGKRZSA-N |
| XLogP | 2.42 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |