C17H31N3O3 — CID 104943758
tert-butyl N-[(1S)-1-[3-(3-butoxypropyl)imidazol-4-yl]ethyl]carbamate (PubChem CID 104943758) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[3-(3-butoxypropyl)imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[3-(3-butoxypropyl)imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 104943758 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | tert-butyl N-[(1S)-1-[3-(3-butoxypropyl)imidazol-4-yl]ethyl]carbamate |
| SMILES | CCCCOCCCn1cncc1[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O3/c1-6-7-10-22-11-8-9-20-13-18-12-15(20)14(2)19-16(21)23-17(3,4)5/h12-14H,6-11H2,1-5H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | HVDFLMMFWQWSPB-AWEZNQCLSA-N |
| XLogP | 3.68 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|