C11H16O2S — CID 83148678
2,3-dimethyl-2-(thiophen-3-ylmethyl)butanoic acid (PubChem CID 83148678) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 2,3-dimethyl-2-(thiophen-3-ylmethyl)butanoic acid.
| Compound Name | 2,3-dimethyl-2-(thiophen-3-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 83148678 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2,3-dimethyl-2-(thiophen-3-ylmethyl)butanoic acid |
| SMILES | CC(C)C(C)(Cc1ccsc1)C(=O)O |
| InChI | InChI=1S/C11H16O2S/c1-8(2)11(3,10(12)13)6-9-4-5-14-7-9/h4-5,7-8H,6H2,1-3H3,(H,12,13) |
| InChIKey | UEBQDFQEPQQMGC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |