C17H26O2 — CID 83148534
2-[(4-tert-butylphenyl)methyl]-2,3-dimethylbutanoic acid (PubChem CID 83148534) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-2,3-dimethylbutanoic acid.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 83148534 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-2,3-dimethylbutanoic acid |
| SMILES | CC(C)C(C)(Cc1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C17H26O2/c1-12(2)17(6,15(18)19)11-13-7-9-14(10-8-13)16(3,4)5/h7-10,12H,11H2,1-6H3,(H,18,19) |
| InChIKey | MFRCZKPGPYYFQN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |