C17H26O2 — CID 63402911
2-[(4-tert-butylphenyl)methyl]-2-ethylbutanoic acid (PubChem CID 63402911) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 63402911 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Cc1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C17H26O2/c1-6-17(7-2,15(18)19)12-13-8-10-14(11-9-13)16(3,4)5/h8-11H,6-7,12H2,1-5H3,(H,18,19) |
| InChIKey | ZGSLWDSMXWPSMO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |